Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium Pyrophosphate, 10-Hydrate, Crystal, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 13472-36-1 Molecular Formula: H20Na4O17P2 Molecular Weight (g/mol): 446.05 InChI Key: VZWGHDYJGOMEKT-UHFFFAOYSA-J Synonym: sodium pyrophosphate decahydrate,unii-iy3dkb96qw,tetrasodium pyrophosphate decahydrate,diphosphoric acid, tetrasodium salt, decahydrate,iy3dkb96qw,pyrophosphate sodium salt decahydrate,pyrophosphate inorganic,colostrum,sodium phosphate pyro,sodium pyrophosphate na4p2o7 decahydrate PubChem CID: 3084150 IUPAC Name: tetrasodium;phosphonato phosphate;decahydrate SMILES: O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+].[Na+]
| PubChem CID | 3084150 |
|---|---|
| CAS | 13472-36-1 |
| Molecular Weight (g/mol) | 446.05 |
| SMILES | O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+].[Na+] |
| Synonym | sodium pyrophosphate decahydrate,unii-iy3dkb96qw,tetrasodium pyrophosphate decahydrate,diphosphoric acid, tetrasodium salt, decahydrate,iy3dkb96qw,pyrophosphate sodium salt decahydrate,pyrophosphate inorganic,colostrum,sodium phosphate pyro,sodium pyrophosphate na4p2o7 decahydrate |
| IUPAC Name | tetrasodium;phosphonato phosphate;decahydrate |
| InChI Key | VZWGHDYJGOMEKT-UHFFFAOYSA-J |
| Molecular Formula | H20Na4O17P2 |
Ammonium tetrafluoroborate, 99%, pure
CAS: 13826-83-0 Molecular Formula: BF4H4N Molecular Weight (g/mol): 104.84 MDL Number: MFCD06245785 InChI Key: PDTKOBRZPAIMRD-UHFFFAOYSA-O Synonym: ammonium tetrafluoroborate,ammonium fluoroborate,ammonium fluoborate,ammonium borofluoride,unii-c945z80o8x,ammonium tetrafluroborate,azanium tetrafluoroborate,arnmonium tetrafluoroborate,nh4bf4,ksc492c2p PubChem CID: 9964072 SMILES: [NH4+].F[B-](F)(F)F
| PubChem CID | 9964072 |
|---|---|
| CAS | 13826-83-0 |
| Molecular Weight (g/mol) | 104.84 |
| MDL Number | MFCD06245785 |
| SMILES | [NH4+].F[B-](F)(F)F |
| Synonym | ammonium tetrafluoroborate,ammonium fluoroborate,ammonium fluoborate,ammonium borofluoride,unii-c945z80o8x,ammonium tetrafluroborate,azanium tetrafluoroborate,arnmonium tetrafluoroborate,nh4bf4,ksc492c2p |
| InChI Key | PDTKOBRZPAIMRD-UHFFFAOYSA-O |
| Molecular Formula | BF4H4N |
Potassium Phosphate, Monobasic, Ultrapure Bioreagent, J.T. Baker™
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium;dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium;dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
Potassium Chloride, >99%, MP Biomedicals™
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| CAS | 7447-40-7 |
|---|---|
| Molecular Weight (g/mol) | 74.55 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
(3-Aminopropyl)diethoxymethylsilane, 97%
CAS: 3179-76-8 Molecular Formula: C8H21NO2Si Molecular Weight (g/mol): 191.346 MDL Number: MFCD00039785 InChI Key: HXLAEGYMDGUSBD-UHFFFAOYSA-N Synonym: 3-aminopropylmethyldiethoxysilane,3-diethoxymethylsilyl propylamine,dynasylan 1506,3-aminopropyl-methyl-diethoxysilane,1-propanamine, 3-diethoxymethylsilyl,dynasylan 1505,3-aminopropyl diethoxymethylsilane,3-diethoxy methyl silyl propan-1-amine,unii-a36to38mqn,gamma-aminopropylmethyldiethoxysilane PubChem CID: 18511 IUPAC Name: 3-[diethoxy(methyl)silyl]propan-1-amine SMILES: CCO[Si](C)(CCCN)OCC
| PubChem CID | 18511 |
|---|---|
| CAS | 3179-76-8 |
| Molecular Weight (g/mol) | 191.346 |
| MDL Number | MFCD00039785 |
| SMILES | CCO[Si](C)(CCCN)OCC |
| Synonym | 3-aminopropylmethyldiethoxysilane,3-diethoxymethylsilyl propylamine,dynasylan 1506,3-aminopropyl-methyl-diethoxysilane,1-propanamine, 3-diethoxymethylsilyl,dynasylan 1505,3-aminopropyl diethoxymethylsilane,3-diethoxy methyl silyl propan-1-amine,unii-a36to38mqn,gamma-aminopropylmethyldiethoxysilane |
| IUPAC Name | 3-[diethoxy(methyl)silyl]propan-1-amine |
| InChI Key | HXLAEGYMDGUSBD-UHFFFAOYSA-N |
| Molecular Formula | C8H21NO2Si |
Triethylsilane, 98+%
CAS: 617-86-7 Molecular Formula: C6H15Si Molecular Weight (g/mol): 115.271 MDL Number: MFCD00009018 InChI Key: QXTIBZLKQPJVII-UHFFFAOYSA-N Synonym: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC Name: triethylsilicon SMILES: CC[Si](CC)CC
| PubChem CID | 6327258 |
|---|---|
| CAS | 617-86-7 |
| Molecular Weight (g/mol) | 115.271 |
| MDL Number | MFCD00009018 |
| SMILES | CC[Si](CC)CC |
| Synonym | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
| IUPAC Name | triethylsilicon |
| InChI Key | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| Molecular Formula | C6H15Si |
Antimony Trichloride TS, (U.S.P. Test Solution), Spectrum™ Chemical
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K IUPAC Name: antimony(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| CAS | 10025-91-9 |
|---|---|
| Molecular Weight (g/mol) | 228.11 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| IUPAC Name | antimony(3+) trichloride |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Boron tribromide, 99+%
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |
Boric Anhydride, Purified, J.T. Baker™
CAS: 1303-86-2 Molecular Formula: B2O3 Molecular Weight (g/mol): 69.62 MDL Number: MFCD00011315 InChI Key: JKWMSGQKBLHBQQ-UHFFFAOYSA-N Synonym: boron trioxide,boric oxide,boric anhydride,boric acid anhydride,oxo oxoboranyloxy borane,boronoxide,diboron trioxide,boron sesquioxide,boron oxide,boron oxide 500g PubChem CID: 518682 ChEBI: CHEBI:30163 SMILES: O=BOB=O
| PubChem CID | 518682 |
|---|---|
| CAS | 1303-86-2 |
| Molecular Weight (g/mol) | 69.62 |
| ChEBI | CHEBI:30163 |
| MDL Number | MFCD00011315 |
| SMILES | O=BOB=O |
| Synonym | boron trioxide,boric oxide,boric anhydride,boric acid anhydride,oxo oxoboranyloxy borane,boronoxide,diboron trioxide,boron sesquioxide,boron oxide,boron oxide 500g |
| InChI Key | JKWMSGQKBLHBQQ-UHFFFAOYSA-N |
| Molecular Formula | B2O3 |
Dichloromethylphenylsilane, 98%
CAS: 149-74-6 Molecular Formula: C7H8Cl2Si Molecular Weight (g/mol): 191.13 MDL Number: MFCD00000490 InChI Key: GNEPOXWQWFSSOU-UHFFFAOYSA-N Synonym: methylphenyldichlorosilane,dichloro methyl phenylsilane,phenylmethyldichlorosilane,silane, dichloromethylphenyl,dichlor-fenyl-methylsilane,dichloro methyl phenyl silane,dichloromethylphenyl silane,unii-9jr2a9v0ji,9jr2a9v0ji,benzene, dichloromethylsilyl PubChem CID: 9006 IUPAC Name: dichloro-methyl-phenylsilane SMILES: C[Si](Cl)(Cl)C1=CC=CC=C1
| PubChem CID | 9006 |
|---|---|
| CAS | 149-74-6 |
| Molecular Weight (g/mol) | 191.13 |
| MDL Number | MFCD00000490 |
| SMILES | C[Si](Cl)(Cl)C1=CC=CC=C1 |
| Synonym | methylphenyldichlorosilane,dichloro methyl phenylsilane,phenylmethyldichlorosilane,silane, dichloromethylphenyl,dichlor-fenyl-methylsilane,dichloro methyl phenyl silane,dichloromethylphenyl silane,unii-9jr2a9v0ji,9jr2a9v0ji,benzene, dichloromethylsilyl |
| IUPAC Name | dichloro-methyl-phenylsilane |
| InChI Key | GNEPOXWQWFSSOU-UHFFFAOYSA-N |
| Molecular Formula | C7H8Cl2Si |
| CAS | 7446-08-4 |
|---|
Antimony(V) chloride, 99.997% (metals basis)
CAS: 7647-18-9 Molecular Formula: Cl5Sb Molecular Weight (g/mol): 299.02 MDL Number: MFCD00011213 InChI Key: VMPVEPPRYRXYNP-UHFFFAOYSA-I Synonym: antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german PubChem CID: 24294 IUPAC Name: antimony pentachloride SMILES: Cl[Sb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24294 |
|---|---|
| CAS | 7647-18-9 |
| Molecular Weight (g/mol) | 299.02 |
| MDL Number | MFCD00011213 |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | antimony pentachloride |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Molecular Formula | Cl5Sb |
Diphenyldichlorosilane, 97%
CAS: 80-10-4 Molecular Formula: C12H10Cl2Si Molecular Weight (g/mol): 253.20 MDL Number: MFCD00000489 InChI Key: OSXYHAQZDCICNX-UHFFFAOYSA-N Synonym: diphenyldichlorosilane,silane, dichlorodiphenyl,dichloro diphenyl silane,diphenylsilicon dichloride,diphenylsilyl dichloride,dichlor-difenylsilan,diphenyl dichlorosilane,dichlor-difenylsilan czech,hsdb 316,benzene, 1,1'-dichlorosilylene bis PubChem CID: 6627 IUPAC Name: dichloro(diphenyl)silane SMILES: Cl[Si](Cl)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6627 |
|---|---|
| CAS | 80-10-4 |
| Molecular Weight (g/mol) | 253.20 |
| MDL Number | MFCD00000489 |
| SMILES | Cl[Si](Cl)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyldichlorosilane,silane, dichlorodiphenyl,dichloro diphenyl silane,diphenylsilicon dichloride,diphenylsilyl dichloride,dichlor-difenylsilan,diphenyl dichlorosilane,dichlor-difenylsilan czech,hsdb 316,benzene, 1,1'-dichlorosilylene bis |
| IUPAC Name | dichloro(diphenyl)silane |
| InChI Key | OSXYHAQZDCICNX-UHFFFAOYSA-N |
| Molecular Formula | C12H10Cl2Si |
5-Trimethylsilyl-4-pentyn-1-ol, 97%
CAS: 13224-84-5 Molecular Formula: C8H16OSi Molecular Weight (g/mol): 156.3 MDL Number: MFCD00190229 InChI Key: LIHAMNSEAAPIRM-UHFFFAOYSA-N PubChem CID: 2760861 IUPAC Name: 5-trimethylsilylpent-4-yn-1-ol SMILES: C[Si](C)(C)C#CCCCO
| PubChem CID | 2760861 |
|---|---|
| CAS | 13224-84-5 |
| Molecular Weight (g/mol) | 156.3 |
| MDL Number | MFCD00190229 |
| SMILES | C[Si](C)(C)C#CCCCO |
| IUPAC Name | 5-trimethylsilylpent-4-yn-1-ol |
| InChI Key | LIHAMNSEAAPIRM-UHFFFAOYSA-N |
| Molecular Formula | C8H16OSi |
(Triethylsilyl)acetylene, 97%
CAS: 1777-03-3 Molecular Formula: C8H16Si Molecular Weight (g/mol): 140.30 MDL Number: MFCD00075373 InChI Key: FWSPXZXVNVQHIF-UHFFFAOYSA-N Synonym: triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane PubChem CID: 637947 IUPAC Name: triethyl(ethynyl)silane SMILES: CC[Si](CC)(CC)C#C
| PubChem CID | 637947 |
|---|---|
| CAS | 1777-03-3 |
| Molecular Weight (g/mol) | 140.30 |
| MDL Number | MFCD00075373 |
| SMILES | CC[Si](CC)(CC)C#C |
| Synonym | triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane |
| IUPAC Name | triethyl(ethynyl)silane |
| InChI Key | FWSPXZXVNVQHIF-UHFFFAOYSA-N |
| Molecular Formula | C8H16Si |